C40H25NO8 — CID 126187854
(2-naphthalen-1-yl-2-oxoethyl) 2-[2-(2-naphthalen-1-yl-2-oxoethoxy)carbonylphenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126187854) has the molecular formula C40H25NO8 and a molecular weight of 647.64 g/mol. Its IUPAC name is (2-naphthalen-1-yl-2-oxoethyl) 2-[2-(2-naphthalen-1-yl-2-oxoethoxy)carbonylphenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2-naphthalen-1-yl-2-oxoethyl) 2-[2-(2-naphthalen-1-yl-2-oxoethoxy)carbonylphenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126187854 |
| Molecular Formula | C40H25NO8 |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 647.16 |
| IUPAC Name | (2-naphthalen-1-yl-2-oxoethyl) 2-[2-(2-naphthalen-1-yl-2-oxoethoxy)carbonylphenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCC(=O)c1cccc2ccccc12)c1ccc2c(c1)C(=O)N(c1ccccc1C(=O)OCC(=O)c1cccc3ccccc13)C2=O |
| InChI | InChI=1S/C40H25NO8/c42-35(29-16-7-11-24-9-1-3-13-27(24)29)22-48-39(46)26-19-20-31-33(21-26)38(45)41(37(31)44)34-18-6-5-15-32(34)40(47)49-23-36(43)30-17-8-12-25-10-2-4-14-28(25)30/h1-21H,22-23H2 |
| InChIKey | DISAILFZVCDOEB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|