C26H18Cl3NO6 — CID 126188557
[2-(4-ethylphenyl)-2-oxoethyl] 5-chloro-4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-2-methoxybenzoate (PubChem CID 126188557) has the molecular formula C26H18Cl3NO6 and a molecular weight of 546.79 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-2-oxoethyl] 5-chloro-4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-2-methoxybenzoate.
| Compound Name | [2-(4-ethylphenyl)-2-oxoethyl] 5-chloro-4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 126188557 |
| Molecular Formula | C26H18Cl3NO6 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | [2-(4-ethylphenyl)-2-oxoethyl] 5-chloro-4-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-2-methoxybenzoate |
| SMILES | CCc1ccc(C(=O)COC(=O)c2cc(Cl)c(N3C(=O)c4cc(Cl)c(Cl)cc4C3=O)cc2OC)cc1 |
| InChI | InChI=1S/C26H18Cl3NO6/c1-3-13-4-6-14(7-5-13)22(31)12-36-26(34)17-10-20(29)21(11-23(17)35-2)30-24(32)15-8-18(27)19(28)9-16(15)25(30)33/h4-11H,3,12H2,1-2H3 |
| InChIKey | KFPDTPZMQLLISL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|