C30H20N2O8 — CID 126183842
[(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126183842) has the molecular formula C30H20N2O8 and a molecular weight of 536.50 g/mol. Its IUPAC name is [(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126183842 |
| Molecular Formula | C30H20N2O8 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | [(1R)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | COc1ccc(C(=O)[C@H](OC(=O)c2ccccc2N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H20N2O8/c1-39-20-16-14-18(15-17-20)26(33)27(19-8-3-2-4-9-19)40-30(36)21-10-5-6-12-23(21)31-28(34)22-11-7-13-24(32(37)38)25(22)29(31)35/h2-17,27H,1H3/t27-/m1/s1 |
| InChIKey | CDRUSCYKBLNGPC-HHHXNRCGSA-N |
| XLogP | 5.18 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|