C30H19N3O9 — CID 126188495
[(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-methyl-3-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126188495) has the molecular formula C30H19N3O9 and a molecular weight of 565.49 g/mol. Its IUPAC name is [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-methyl-3-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-methyl-3-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126188495 |
| Molecular Formula | C30H19N3O9 |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-methyl-3-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | Cc1ccc(C(=O)O[C@H](C(=O)c2ccccc2)c2ccc([N+](=O)[O-])cc2)cc1N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C30H19N3O9/c1-17-10-11-20(16-24(17)31-28(35)22-8-5-9-23(33(40)41)25(22)29(31)36)30(37)42-27(26(34)18-6-3-2-4-7-18)19-12-14-21(15-13-19)32(38)39/h2-16,27H,1H3/t27-/m0/s1 |
| InChIKey | JJCKLVOLOUYJPU-MHZLTWQESA-N |
| XLogP | 5.39 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|