C29H22N2O7 — CID 126188433
[(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate (PubChem CID 126188433) has the molecular formula C29H22N2O7 and a molecular weight of 510.50 g/mol. Its IUPAC name is [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate.
| Compound Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 126188433 |
| Molecular Formula | C29H22N2O7 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
| SMILES | O=C(O[C@H](C(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1)c1cccc(N2C(=O)[C@H]3CC=CC[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C29H22N2O7/c32-25(18-7-2-1-3-8-18)26(19-13-15-21(16-14-19)31(36)37)38-29(35)20-9-6-10-22(17-20)30-27(33)23-11-4-5-12-24(23)28(30)34/h1-10,13-17,23-24,26H,11-12H2/t23-,24-,26-/m0/s1 |
| InChIKey | IQTCCUPAVDLIKX-GNKBHMEESA-N |
| XLogP | 4.83 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|