C29H23NO5 — CID 27153295
[(1R)-2-oxo-1,2-diphenylethyl] 4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate (PubChem CID 27153295) has the molecular formula C29H23NO5 and a molecular weight of 465.51 g/mol. Its IUPAC name is [(1R)-2-oxo-1,2-diphenylethyl] 4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate.
| Compound Name | [(1R)-2-oxo-1,2-diphenylethyl] 4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 27153295 |
| Molecular Formula | C29H23NO5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [(1R)-2-oxo-1,2-diphenylethyl] 4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
| SMILES | O=C(O[C@@H](C(=O)c1ccccc1)c1ccccc1)c1ccc(N2C(=O)[C@H]3CC=CC[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C29H23NO5/c31-25(19-9-3-1-4-10-19)26(20-11-5-2-6-12-20)35-29(34)21-15-17-22(18-16-21)30-27(32)23-13-7-8-14-24(23)28(30)33/h1-12,15-18,23-24,26H,13-14H2/t23-,24-,26+/m0/s1 |
| InChIKey | OKJSPCADIGTKSD-KYPHJKQUSA-N |
| XLogP | 4.92 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|