C24H21NO5 — CID 2902796
(1-oxo-1-phenylpropan-2-yl) 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate (PubChem CID 2902796) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 2902796 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate |
| SMILES | CC(OC(=O)c1ccccc1N1C(=O)C2CC=CCC2C1=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21NO5/c1-15(21(26)16-9-3-2-4-10-16)30-24(29)19-13-7-8-14-20(19)25-22(27)17-11-5-6-12-18(17)23(25)28/h2-10,13-15,17-18H,11-12H2,1H3 |
| InChIKey | YJYHXTHZKFWVIC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|