C35H21ClN2O8 — CID 126185194
[(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 3-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 126185194) has the molecular formula C35H21ClN2O8 and a molecular weight of 633.01 g/mol. Its IUPAC name is [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 3-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 3-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 126185194 |
| Molecular Formula | C35H21ClN2O8 |
| Molecular Weight | 633.01 g/mol |
| Exact Mass | 632.10 |
| IUPAC Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 3-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | O=C(O[C@H](C(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1)c1cccc(N2C(=O)c3cccc(Oc4ccc(Cl)cc4)c3C2=O)c1 |
| InChI | InChI=1S/C35H21ClN2O8/c36-24-14-18-27(19-15-24)45-29-11-5-10-28-30(29)34(41)37(33(28)40)26-9-4-8-23(20-26)35(42)46-32(31(39)21-6-2-1-3-7-21)22-12-16-25(17-13-22)38(43)44/h1-20,32H/t32-/m0/s1 |
| InChIKey | KMQYXULMAJVQHO-YTTGMZPUSA-N |
| XLogP | 7.62 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.01 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|