C25H18N2O7 — CID 1315910
[(2S)-1-oxo-1-phenylbutan-2-yl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 1315910) has the molecular formula C25H18N2O7 and a molecular weight of 458.43 g/mol. Its IUPAC name is [(2S)-1-oxo-1-phenylbutan-2-yl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [(2S)-1-oxo-1-phenylbutan-2-yl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 1315910 |
| Molecular Formula | C25H18N2O7 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [(2S)-1-oxo-1-phenylbutan-2-yl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | CC[C@H](OC(=O)c1cccc(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H18N2O7/c1-2-20(22(28)15-8-4-3-5-9-15)34-25(31)16-10-6-11-17(14-16)26-23(29)18-12-7-13-19(27(32)33)21(18)24(26)30/h3-14,20H,2H2,1H3/t20-/m0/s1 |
| InChIKey | QFPPNELWLCUMMV-FQEVSTJZSA-N |
| XLogP | 4.21 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|