C32H22N2O9 — CID 19646099
[4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate (PubChem CID 19646099) has the molecular formula C32H22N2O9 and a molecular weight of 578.53 g/mol. Its IUPAC name is [4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate.
| Compound Name | [4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate |
|---|---|
| PubChem CID | 19646099 |
| Molecular Formula | C32H22N2O9 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | [4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate |
| SMILES | O=C(COC(=O)C(Cc1ccccc1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O)c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H22N2O9/c35-27(21-14-16-23(17-15-21)43-31(38)22-10-5-2-6-11-22)19-42-32(39)26(18-20-8-3-1-4-9-20)33-29(36)24-12-7-13-25(34(40)41)28(24)30(33)37/h1-17,26H,18-19H2 |
| InChIKey | RMEHGARCWKZICW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|