C32H27Br2NO7 — CID 19645861
[4-[2-[2-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate (PubChem CID 19645861) has the molecular formula C32H27Br2NO7 and a molecular weight of 697.38 g/mol. Its IUPAC name is [4-[2-[2-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate.
| Compound Name | [4-[2-[2-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate |
|---|---|
| PubChem CID | 19645861 |
| Molecular Formula | C32H27Br2NO7 |
| Molecular Weight | 697.38 g/mol |
| Exact Mass | 695.02 |
| IUPAC Name | [4-[2-[2-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate |
| SMILES | O=C(COC(=O)C(Cc1ccccc1)N1C(=O)C2CC(Br)C(Br)CC2C1=O)c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H27Br2NO7/c33-25-16-23-24(17-26(25)34)30(38)35(29(23)37)27(15-19-7-3-1-4-8-19)32(40)41-18-28(36)20-11-13-22(14-12-20)42-31(39)21-9-5-2-6-10-21/h1-14,23-27H,15-18H2 |
| InChIKey | PTTPMQBYANXMEW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.38 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|