C27H25Br2NO7 — CID 19645891
[4-[2-[2-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoyloxy]acetyl]phenyl] 4-methylbenzoate (PubChem CID 19645891) has the molecular formula C27H25Br2NO7 and a molecular weight of 635.31 g/mol. Its IUPAC name is [4-[2-[2-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoyloxy]acetyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[2-[2-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoyloxy]acetyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 19645891 |
| Molecular Formula | C27H25Br2NO7 |
| Molecular Weight | 635.31 g/mol |
| Exact Mass | 633.00 |
| IUPAC Name | [4-[2-[2-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoyloxy]acetyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(=O)COC(=O)C(C)N3C(=O)C4CC(Br)C(Br)CC4C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H25Br2NO7/c1-14-3-5-17(6-4-14)27(35)37-18-9-7-16(8-10-18)23(31)13-36-26(34)15(2)30-24(32)19-11-21(28)22(29)12-20(19)25(30)33/h3-10,15,19-22H,11-13H2,1-2H3 |
| InChIKey | UATDXJAMLFWYAC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|