C33H27Cl2NO7 — CID 19645909
[4-[2-[2-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] 3,4-dichlorobenzoate (PubChem CID 19645909) has the molecular formula C33H27Cl2NO7 and a molecular weight of 620.49 g/mol. Its IUPAC name is [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] 3,4-dichlorobenzoate.
| Compound Name | [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19645909 |
| Molecular Formula | C33H27Cl2NO7 |
| Molecular Weight | 620.49 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] 3,4-dichlorobenzoate |
| SMILES | CC1=CCC2C(=O)N(C(Cc3ccccc3)C(=O)OCC(=O)c3ccc(OC(=O)c4ccc(Cl)c(Cl)c4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C33H27Cl2NO7/c1-19-7-13-24-25(15-19)31(39)36(30(24)38)28(16-20-5-3-2-4-6-20)33(41)42-18-29(37)21-8-11-23(12-9-21)43-32(40)22-10-14-26(34)27(35)17-22/h2-12,14,17,24-25,28H,13,15-16,18H2,1H3 |
| InChIKey | MELVTWDQIGEFCS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_B(2)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|