C26H18N2O9 — CID 19646141
[4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]phenyl] benzoate (PubChem CID 19646141) has the molecular formula C26H18N2O9 and a molecular weight of 502.44 g/mol. Its IUPAC name is [4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]phenyl] benzoate.
| Compound Name | [4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]phenyl] benzoate |
|---|---|
| PubChem CID | 19646141 |
| Molecular Formula | C26H18N2O9 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | [4-[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxy]acetyl]phenyl] benzoate |
| SMILES | CC(C(=O)OCC(=O)c1ccc(OC(=O)c2ccccc2)cc1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C26H18N2O9/c1-15(27-23(30)19-8-5-9-20(28(34)35)22(19)24(27)31)25(32)36-14-21(29)16-10-12-18(13-11-16)37-26(33)17-6-3-2-4-7-17/h2-13,15H,14H2,1H3 |
| InChIKey | XLYBAPPATVXUOA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|