C24H23NO4 — CID 11900462
(1R,2R,6S,7S)-4-[2-[(2S)-1-oxo-1-phenylpropan-2-yl]oxyphenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 11900462) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-[2-[(2S)-1-oxo-1-phenylpropan-2-yl]oxyphenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6S,7S)-4-[2-[(2S)-1-oxo-1-phenylpropan-2-yl]oxyphenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 11900462 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (1R,2R,6S,7S)-4-[2-[(2S)-1-oxo-1-phenylpropan-2-yl]oxyphenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C[C@H](Oc1ccccc1N1C(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23NO4/c1-14(22(26)15-7-3-2-4-8-15)29-19-10-6-5-9-18(19)25-23(27)20-16-11-12-17(13-16)21(20)24(25)28/h2-10,14,16-17,20-21H,11-13H2,1H3/t14-,16-,17+,20-,21+/m0/s1 |
| InChIKey | NOBDNBRERHSZKY-XUNHBOFMSA-N |
| XLogP | 3.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|