C21H21Br2NO6 — CID 124720684
[2-(3-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1R,2S,6R,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate (PubChem CID 124720684) has the molecular formula C21H21Br2NO6 and a molecular weight of 543.21 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1R,2S,6R,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1R,2S,6R,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
|---|---|
| PubChem CID | 124720684 |
| Molecular Formula | C21H21Br2NO6 |
| Molecular Weight | 543.21 g/mol |
| Exact Mass | 540.97 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] (2S)-2-[(1R,2S,6R,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
| SMILES | COc1cccc(C(=O)COC(=O)[C@H](C)N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@H](Br)[C@@H]4Br)[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C21H21Br2NO6/c1-9(21(28)30-8-14(25)10-4-3-5-11(6-10)29-2)24-19(26)15-12-7-13(16(15)20(24)27)18(23)17(12)22/h3-6,9,12-13,15-18H,7-8H2,1-2H3/t9-,12+,13+,15-,16+,17-,18+/m0/s1 |
| InChIKey | LKXBETPEAKBTSM-LHRFKPOLSA-N |
| XLogP | 2.59 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|