C15H14F3NO5 — CID 99803552
2-(1,3-dioxoisoindol-2-yl)ethyl (2R)-2-(2,2,2-trifluoroethoxy)propanoate (PubChem CID 99803552) has the molecular formula C15H14F3NO5 and a molecular weight of 345.27 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl (2R)-2-(2,2,2-trifluoroethoxy)propanoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2R)-2-(2,2,2-trifluoroethoxy)propanoate |
|---|---|
| PubChem CID | 99803552 |
| Molecular Formula | C15H14F3NO5 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2R)-2-(2,2,2-trifluoroethoxy)propanoate |
| SMILES | C[C@@H](OCC(F)(F)F)C(=O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14F3NO5/c1-9(24-8-15(16,17)18)14(22)23-7-6-19-12(20)10-4-2-3-5-11(10)13(19)21/h2-5,9H,6-8H2,1H3/t9-/m1/s1 |
| InChIKey | DYOCJROCXNVANX-SECBINFHSA-N |
| XLogP | 1.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|