C19H14F3NO4 — CID 7767496
2-(1,3-dioxoisoindol-2-yl)ethyl 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 7767496) has the molecular formula C19H14F3NO4 and a molecular weight of 377.32 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 7767496 |
| Molecular Formula | C19H14F3NO4 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H14F3NO4/c20-19(21,22)13-5-3-4-12(10-13)11-16(24)27-9-8-23-17(25)14-6-1-2-7-15(14)18(23)26/h1-7,10H,8-9,11H2 |
| InChIKey | YOWYWGDXYLQPLB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|