C28H26ClNO5 — CID 18173190
2-[1-[4-(4-chlorophenyl)phenyl]ethoxymethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid (PubChem CID 18173190) has the molecular formula C28H26ClNO5 and a molecular weight of 491.97 g/mol. Its IUPAC name is 2-[1-[4-(4-chlorophenyl)phenyl]ethoxymethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid.
| Compound Name | 2-[1-[4-(4-chlorophenyl)phenyl]ethoxymethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 18173190 |
| Molecular Formula | C28H26ClNO5 |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 2-[1-[4-(4-chlorophenyl)phenyl]ethoxymethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
| SMILES | CC(OCC(CCCN1C(=O)c2ccccc2C1=O)C(=O)O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H26ClNO5/c1-18(19-8-10-20(11-9-19)21-12-14-23(29)15-13-21)35-17-22(28(33)34)5-4-16-30-26(31)24-6-2-3-7-25(24)27(30)32/h2-3,6-15,18,22H,4-5,16-17H2,1H3,(H,33,34) |
| InChIKey | JWPKWUXEASCNRO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|