C21H15ClNO6- — CID 9368148
2-[(4Z)-4-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate (PubChem CID 9368148) has the molecular formula C21H15ClNO6- and a molecular weight of 412.81 g/mol. Its IUPAC name is 2-[(4Z)-4-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate.
| Compound Name | 2-[(4Z)-4-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 9368148 |
| Molecular Formula | C21H15ClNO6- |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-[(4Z)-4-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
| SMILES | O=C([O-])CN1C(=O)/C(=C\c2cc(Cl)c3c(c2)OCCCO3)c2ccccc2C1=O |
| InChI | InChI=1S/C21H16ClNO6/c22-16-9-12(10-17-19(16)29-7-3-6-28-17)8-15-13-4-1-2-5-14(13)20(26)23(21(15)27)11-18(24)25/h1-2,4-5,8-10H,3,6-7,11H2,(H,24,25)/p-1/b15-8- |
| InChIKey | JGFDOUHAQUDSAU-NVNXTCNLSA-M |
| XLogP | 1.77 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|