C21H20N2O5 — CID 136894948
(4E)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylidene)-2-(3,5-dimethoxyphenyl)-1H-imidazol-5-one (PubChem CID 136894948) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is (4E)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylidene)-2-(3,5-dimethoxyphenyl)-1H-imidazol-5-one.
| Compound Name | (4E)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylidene)-2-(3,5-dimethoxyphenyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894948 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (4E)-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylidene)-2-(3,5-dimethoxyphenyl)-1H-imidazol-5-one |
| SMILES | COc1cc(OC)cc(C2=N/C(=C/c3ccc4c(c3)OCCCO4)C(=O)N2)c1 |
| InChI | InChI=1S/C21H20N2O5/c1-25-15-10-14(11-16(12-15)26-2)20-22-17(21(24)23-20)8-13-4-5-18-19(9-13)28-7-3-6-27-18/h4-5,8-12H,3,6-7H2,1-2H3,(H,22,23,24)/b17-8+ |
| InChIKey | MAIJFQOIVOIAFC-CAOOACKPSA-N |
| XLogP | 2.78 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|