C21H17BrINO5 — CID 19669703
[4-[(Z)-[2-(3-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] butanoate (PubChem CID 19669703) has the molecular formula C21H17BrINO5 and a molecular weight of 570.18 g/mol. Its IUPAC name is [4-[(Z)-[2-(3-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] butanoate.
| Compound Name | [4-[(Z)-[2-(3-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] butanoate |
|---|---|
| PubChem CID | 19669703 |
| Molecular Formula | C21H17BrINO5 |
| Molecular Weight | 570.18 g/mol |
| Exact Mass | 568.93 |
| IUPAC Name | [4-[(Z)-[2-(3-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] butanoate |
| SMILES | CCCC(=O)Oc1c(I)cc(/C=C2\N=C(c3cccc(Br)c3)OC2=O)cc1OC |
| InChI | InChI=1S/C21H17BrINO5/c1-3-5-18(25)28-19-15(23)8-12(10-17(19)27-2)9-16-21(26)29-20(24-16)13-6-4-7-14(22)11-13/h4,6-11H,3,5H2,1-2H3/b16-9- |
| InChIKey | HYTDTMAOCPPVNS-SXGWCWSVSA-N |
| XLogP | 5.11 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.18 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|