C20H16BrNO6 — CID 4888838
[4-[[2-(3-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] ethyl carbonate (PubChem CID 4888838) has the molecular formula C20H16BrNO6 and a molecular weight of 446.25 g/mol. Its IUPAC name is [4-[[2-(3-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] ethyl carbonate.
| Compound Name | [4-[[2-(3-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] ethyl carbonate |
|---|---|
| PubChem CID | 4888838 |
| Molecular Formula | C20H16BrNO6 |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | [4-[[2-(3-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C=C2N=C(c3cccc(Br)c3)OC2=O)cc1OC |
| InChI | InChI=1S/C20H16BrNO6/c1-3-26-20(24)27-16-8-7-12(10-17(16)25-2)9-15-19(23)28-18(22-15)13-5-4-6-14(21)11-13/h4-11H,3H2,1-2H3 |
| InChIKey | HYUKZSIDNCMVFK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|