C21H18BrNO5 — CID 19663031
[4-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methylpropanoate (PubChem CID 19663031) has the molecular formula C21H18BrNO5 and a molecular weight of 444.28 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methylpropanoate.
| Compound Name | [4-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 19663031 |
| Molecular Formula | C21H18BrNO5 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | [4-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-methylpropanoate |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(Br)cc3)OC2=O)ccc1OC(=O)C(C)C |
| InChI | InChI=1S/C21H18BrNO5/c1-12(2)20(24)27-17-9-4-13(11-18(17)26-3)10-16-21(25)28-19(23-16)14-5-7-15(22)8-6-14/h4-12H,1-3H3/b16-10- |
| InChIKey | RUCNBUJKGFOTFM-YBEGLDIGSA-N |
| XLogP | 4.36 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|