C25H18BrNO5 — CID 126197987
[2-methoxy-4-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 126197987) has the molecular formula C25H18BrNO5 and a molecular weight of 492.33 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2-methoxy-4-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 126197987 |
| Molecular Formula | C25H18BrNO5 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | [2-methoxy-4-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | COc1cc(/C=C2\N=C(c3cccc(C)c3)OC2=O)ccc1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H18BrNO5/c1-15-4-3-5-18(12-15)23-27-20(25(29)32-23)13-16-6-11-21(22(14-16)30-2)31-24(28)17-7-9-19(26)10-8-17/h3-14H,1-2H3/b20-13- |
| InChIKey | MKPOFQWOGNCCFU-MOSHPQCFSA-N |
| XLogP | 5.33 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|