C26H20ClNO5 — CID 126211254
[4-[(Z)-[2-(3-chloro-4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-methylbenzoate (PubChem CID 126211254) has the molecular formula C26H20ClNO5 and a molecular weight of 461.90 g/mol. Its IUPAC name is [4-[(Z)-[2-(3-chloro-4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-methylbenzoate.
| Compound Name | [4-[(Z)-[2-(3-chloro-4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126211254 |
| Molecular Formula | C26H20ClNO5 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | [4-[(Z)-[2-(3-chloro-4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-methylbenzoate |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(C)c(Cl)c3)OC2=O)ccc1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C26H20ClNO5/c1-15-5-4-6-19(11-15)25(29)32-22-10-8-17(13-23(22)31-3)12-21-26(30)33-24(28-21)18-9-7-16(2)20(27)14-18/h4-14H,1-3H3/b21-12- |
| InChIKey | NKQMVCWKBLSNMZ-MTJSOVHGSA-N |
| XLogP | 5.53 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|