C22H20INO5 — CID 19671673
[4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] butanoate (PubChem CID 19671673) has the molecular formula C22H20INO5 and a molecular weight of 505.31 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] butanoate.
| Compound Name | [4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] butanoate |
|---|---|
| PubChem CID | 19671673 |
| Molecular Formula | C22H20INO5 |
| Molecular Weight | 505.31 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | [4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(/C=C2\N=C(c3ccc(I)c(C)c3)OC2=O)cc1OC |
| InChI | InChI=1S/C22H20INO5/c1-4-5-20(25)28-18-9-6-14(12-19(18)27-3)11-17-22(26)29-21(24-17)15-7-8-16(23)13(2)10-15/h6-12H,4-5H2,1-3H3/b17-11- |
| InChIKey | DCNBUEBYBUEYCK-BOPFTXTBSA-N |
| XLogP | 4.66 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|