C28H24N2O8 — CID 126012806
[4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-nitrobenzoate (PubChem CID 126012806) has the molecular formula C28H24N2O8 and a molecular weight of 516.51 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-nitrobenzoate.
| Compound Name | [4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 126012806 |
| Molecular Formula | C28H24N2O8 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | [4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-nitrobenzoate |
| SMILES | CCCCOc1ccc(C2=N/C(=C\c3ccc(OC(=O)c4cccc([N+](=O)[O-])c4)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C28H24N2O8/c1-3-4-14-36-22-11-9-19(10-12-22)26-29-23(28(32)38-26)15-18-8-13-24(25(16-18)35-2)37-27(31)20-6-5-7-21(17-20)30(33)34/h5-13,15-17H,3-4,14H2,1-2H3/b23-15- |
| InChIKey | YXBKEXULTAJYMV-HAHDFKILSA-N |
| XLogP | 5.35 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|