C25H17FN2O7 — CID 2184671
[2-ethoxy-4-[(E)-[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-nitrobenzoate (PubChem CID 2184671) has the molecular formula C25H17FN2O7 and a molecular weight of 476.42 g/mol. Its IUPAC name is [2-ethoxy-4-[(E)-[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-nitrobenzoate.
| Compound Name | [2-ethoxy-4-[(E)-[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 2184671 |
| Molecular Formula | C25H17FN2O7 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [2-ethoxy-4-[(E)-[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-nitrobenzoate |
| SMILES | CCOc1cc(/C=C2/N=C(c3ccccc3F)OC2=O)ccc1OC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H17FN2O7/c1-2-33-22-13-15(12-20-25(30)35-23(27-20)18-8-3-4-9-19(18)26)10-11-21(22)34-24(29)16-6-5-7-17(14-16)28(31)32/h3-14H,2H2,1H3/b20-12+ |
| InChIKey | BLVSJNSBAKWAAX-UDWIEESQSA-N |
| XLogP | 4.70 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|