C25H19F2NO4 — CID 19668884
(4Z)-4-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-(2-fluorophenyl)-1,3-oxazol-5-one (PubChem CID 19668884) has the molecular formula C25H19F2NO4 and a molecular weight of 435.43 g/mol. Its IUPAC name is (4Z)-4-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-(2-fluorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-(2-fluorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19668884 |
| Molecular Formula | C25H19F2NO4 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (4Z)-4-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-(2-fluorophenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccccc3F)OC2=O)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C25H19F2NO4/c1-2-30-23-14-16(11-12-22(23)31-15-17-7-3-5-9-19(17)26)13-21-25(29)32-24(28-21)18-8-4-6-10-20(18)27/h3-14H,2,15H2,1H3/b21-13- |
| InChIKey | XMWAPONOICJAHY-BKUYFWCQSA-N |
| XLogP | 5.29 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|