C27H20N2O8 — CID 126198595
[2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126198595) has the molecular formula C27H20N2O8 and a molecular weight of 500.46 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126198595 |
| Molecular Formula | C27H20N2O8 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | [2-methoxy-4-[(Z)-[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | COc1ccc(C2=N/C(=C\c3ccc(OC(=O)/C=C/c4cccc([N+](=O)[O-])c4)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C27H20N2O8/c1-34-21-10-8-19(9-11-21)26-28-22(27(31)37-26)15-18-6-12-23(24(16-18)35-2)36-25(30)13-7-17-4-3-5-20(14-17)29(32)33/h3-16H,1-2H3/b13-7+,22-15- |
| InChIKey | BINJEIQMULXSAQ-VEJJZHSVSA-N |
| XLogP | 4.58 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|