C31H28N2O9 — CID 126198889
[4-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126198889) has the molecular formula C31H28N2O9 and a molecular weight of 572.57 g/mol. Its IUPAC name is [4-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [4-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126198889 |
| Molecular Formula | C31H28N2O9 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | [4-[(Z)-[2-(3,4-diethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccc(OC(=O)/C=C/c4cccc([N+](=O)[O-])c4)c(OCC)c3)C(=O)O2)cc1OCC |
| InChI | InChI=1S/C31H28N2O9/c1-4-38-25-14-12-22(19-28(25)40-6-3)30-32-24(31(35)42-30)17-21-10-13-26(27(18-21)39-5-2)41-29(34)15-11-20-8-7-9-23(16-20)33(36)37/h7-19H,4-6H2,1-3H3/b15-11+,24-17- |
| InChIKey | DQHZLVICNSRSJT-CVGIPWMOSA-N |
| XLogP | 5.75 |
| TPSA | 135.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|