C27H20ClNO5 — CID 126196540
[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126196540) has the molecular formula C27H20ClNO5 and a molecular weight of 473.91 g/mol. Its IUPAC name is [4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126196540 |
| Molecular Formula | C27H20ClNO5 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | [4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] (E)-3-phenylprop-2-enoate |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccccc3Cl)OC2=O)ccc1OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C27H20ClNO5/c1-2-32-24-17-19(12-14-23(24)33-25(30)15-13-18-8-4-3-5-9-18)16-22-27(31)34-26(29-22)20-10-6-7-11-21(20)28/h3-17H,2H2,1H3/b15-13+,22-16- |
| InChIKey | RTMUNYXJQMYNTF-JYBPRETJSA-N |
| XLogP | 5.70 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|