C27H22ClNO7 — CID 4219950
[4-[[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] 3-methoxybenzoate (PubChem CID 4219950) has the molecular formula C27H22ClNO7 and a molecular weight of 507.93 g/mol. Its IUPAC name is [4-[[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 4219950 |
| Molecular Formula | C27H22ClNO7 |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | [4-[[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-ethoxyphenyl] 3-methoxybenzoate |
| SMILES | CCOc1cc(C=C2N=C(c3cc(Cl)ccc3OC)OC2=O)ccc1OC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C27H22ClNO7/c1-4-34-24-13-16(8-10-23(24)35-26(30)17-6-5-7-19(14-17)32-2)12-21-27(31)36-25(29-21)20-15-18(28)9-11-22(20)33-3/h5-15H,4H2,1-3H3 |
| InChIKey | TXRWSADDTARWFH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|