C29H26ClNO6 — CID 126010034
[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-tert-butylbenzoate (PubChem CID 126010034) has the molecular formula C29H26ClNO6 and a molecular weight of 519.98 g/mol. Its IUPAC name is [4-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-tert-butylbenzoate.
| Compound Name | [4-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 126010034 |
| Molecular Formula | C29H26ClNO6 |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | [4-[(Z)-[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-tert-butylbenzoate |
| SMILES | COc1cc(/C=C2\N=C(c3cc(Cl)ccc3OC)OC2=O)ccc1OC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H26ClNO6/c1-29(2,3)19-9-7-18(8-10-19)27(32)36-24-12-6-17(15-25(24)35-5)14-22-28(33)37-26(31-22)21-16-20(30)11-13-23(21)34-4/h6-16H,1-5H3/b22-14- |
| InChIKey | GABAQGLPFMCSQZ-HMAPJEAMSA-N |
| XLogP | 6.22 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|