C19H14ClNO4 — CID 9394541
(4Z)-4-[(7-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(3,4-dimethylphenyl)-1,3-oxazol-5-one (PubChem CID 9394541) has the molecular formula C19H14ClNO4 and a molecular weight of 355.78 g/mol. Its IUPAC name is (4Z)-4-[(7-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(3,4-dimethylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(7-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(3,4-dimethylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9394541 |
| Molecular Formula | C19H14ClNO4 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (4Z)-4-[(7-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(3,4-dimethylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccc(C2=N/C(=C\c3cc(Cl)c4c(c3)OCO4)C(=O)O2)cc1C |
| InChI | InChI=1S/C19H14ClNO4/c1-10-3-4-13(5-11(10)2)18-21-15(19(22)25-18)7-12-6-14(20)17-16(8-12)23-9-24-17/h3-8H,9H2,1-2H3/b15-7- |
| InChIKey | HJZGNNGDXUBCGT-CHHVJCJISA-N |
| XLogP | 4.03 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|