C18H12BrNO5 — CID 9312650
(4Z)-4-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(4-methoxyphenyl)-1,3-oxazol-5-one (PubChem CID 9312650) has the molecular formula C18H12BrNO5 and a molecular weight of 402.20 g/mol. Its IUPAC name is (4Z)-4-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(4-methoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(4-methoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9312650 |
| Molecular Formula | C18H12BrNO5 |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | (4Z)-4-[(7-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(4-methoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(C2=N/C(=C\c3cc(Br)c4c(c3)OCO4)C(=O)O2)cc1 |
| InChI | InChI=1S/C18H12BrNO5/c1-22-12-4-2-11(3-5-12)17-20-14(18(21)25-17)7-10-6-13(19)16-15(8-10)23-9-24-16/h2-8H,9H2,1H3/b14-7- |
| InChIKey | FFYXMJVFPNJNMK-AUWJEWJLSA-N |
| XLogP | 3.53 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|