C23H15Cl2NO6S — CID 3788270
[4-[[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 3788270) has the molecular formula C23H15Cl2NO6S and a molecular weight of 504.35 g/mol. Its IUPAC name is [4-[[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 3788270 |
| Molecular Formula | C23H15Cl2NO6S |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | [4-[[2-(5-chloro-2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1ccc(Cl)cc1C1=NC(=Cc2ccc(OS(=O)(=O)c3ccc(Cl)cc3)cc2)C(=O)O1 |
| InChI | InChI=1S/C23H15Cl2NO6S/c1-30-21-11-6-16(25)13-19(21)22-26-20(23(27)31-22)12-14-2-7-17(8-3-14)32-33(28,29)18-9-4-15(24)5-10-18/h2-13H,1H3 |
| InChIKey | HYXIZNOPLOOUJN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|