C22H23BrN2O2 — CID 171981191
(4Z)-2-(3-bromophenyl)-4-[[4-(dipropylamino)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 171981191) has the molecular formula C22H23BrN2O2 and a molecular weight of 427.34 g/mol. Its IUPAC name is (4Z)-2-(3-bromophenyl)-4-[[4-(dipropylamino)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-bromophenyl)-4-[[4-(dipropylamino)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 171981191 |
| Molecular Formula | C22H23BrN2O2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (4Z)-2-(3-bromophenyl)-4-[[4-(dipropylamino)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CCCN(CCC)c1ccc(/C=C2\N=C(c3cccc(Br)c3)OC2=O)cc1 |
| InChI | InChI=1S/C22H23BrN2O2/c1-3-12-25(13-4-2)19-10-8-16(9-11-19)14-20-22(26)27-21(24-20)17-6-5-7-18(23)15-17/h5-11,14-15H,3-4,12-13H2,1-2H3/b20-14- |
| InChIKey | RWDYNDFUOAGKSY-ZHZULCJRSA-N |
| XLogP | 5.42 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|