C17H10ClF2NO3 — CID 4566422
2-(2-chloro-4,5-difluorophenyl)-4-[(2-methoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 4566422) has the molecular formula C17H10ClF2NO3 and a molecular weight of 349.72 g/mol. Its IUPAC name is 2-(2-chloro-4,5-difluorophenyl)-4-[(2-methoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(2-chloro-4,5-difluorophenyl)-4-[(2-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4566422 |
| Molecular Formula | C17H10ClF2NO3 |
| Molecular Weight | 349.72 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-(2-chloro-4,5-difluorophenyl)-4-[(2-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccccc1C=C1N=C(c2cc(F)c(F)cc2Cl)OC1=O |
| InChI | InChI=1S/C17H10ClF2NO3/c1-23-15-5-3-2-4-9(15)6-14-17(22)24-16(21-14)10-7-12(19)13(20)8-11(10)18/h2-8H,1H3 |
| InChIKey | JSXPDADOEGZBHO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.72 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|