C23H23ClN2O5 — CID 22110017
2-[4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetamide (PubChem CID 22110017) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is 2-[4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 22110017 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-chloro-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(C(C)(C)C)cc3)OC2=O)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C23H23ClN2O5/c1-23(2,3)15-7-5-14(6-8-15)21-26-17(22(28)31-21)10-13-9-16(24)20(18(11-13)29-4)30-12-19(25)27/h5-11H,12H2,1-4H3,(H2,25,27)/b17-10- |
| InChIKey | AVJWGSBVUOZMJB-YVLHZVERSA-N |
| XLogP | 3.85 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|