C19H21N3O3S — CID 57269263
3-[(4-ethyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 57269263) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-[(4-ethyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | 3-[(4-ethyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57269263 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-[(4-ethyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CCC1CCCc2[nH]c(C=C3C(=O)Nc4ccc(S(N)(=O)=O)cc43)cc21 |
| InChI | InChI=1S/C19H21N3O3S/c1-2-11-4-3-5-17-14(11)8-12(21-17)9-16-15-10-13(26(20,24)25)6-7-18(15)22-19(16)23/h6-11,21H,2-5H2,1H3,(H,22,23)(H2,20,24,25) |
| InChIKey | CBFISYXOPFUUEI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|