C23H24N4O5S — CID 69343405
(3E)-3-[[5-(2-morpholin-4-ylethoxy)-1H-indol-2-yl]methylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 69343405) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is (3E)-3-[[5-(2-morpholin-4-ylethoxy)-1H-indol-2-yl]methylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | (3E)-3-[[5-(2-morpholin-4-ylethoxy)-1H-indol-2-yl]methylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 69343405 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (3E)-3-[[5-(2-morpholin-4-ylethoxy)-1H-indol-2-yl]methylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)/C(=C\c1cc3cc(OCCN4CCOCC4)ccc3[nH]1)C(=O)N2 |
| InChI | InChI=1S/C23H24N4O5S/c24-33(29,30)18-2-4-22-19(14-18)20(23(28)26-22)13-16-11-15-12-17(1-3-21(15)25-16)32-10-7-27-5-8-31-9-6-27/h1-4,11-14,25H,5-10H2,(H,26,28)(H2,24,29,30)/b20-13+ |
| InChIKey | RTJHQHMDMPRKOW-DEDYPNTBSA-N |
| XLogP | 2.02 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|