C23H24BrN3O2 — CID 22042082
(3Z)-5-bromo-3-[[5-[2-(diethylamino)ethoxy]-1H-indol-2-yl]methylidene]-1H-indol-2-one (PubChem CID 22042082) has the molecular formula C23H24BrN3O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is (3Z)-5-bromo-3-[[5-[2-(diethylamino)ethoxy]-1H-indol-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-bromo-3-[[5-[2-(diethylamino)ethoxy]-1H-indol-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 22042082 |
| Molecular Formula | C23H24BrN3O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (3Z)-5-bromo-3-[[5-[2-(diethylamino)ethoxy]-1H-indol-2-yl]methylidene]-1H-indol-2-one |
| SMILES | CCN(CC)CCOc1ccc2[nH]c(/C=C3\C(=O)Nc4ccc(Br)cc43)cc2c1 |
| InChI | InChI=1S/C23H24BrN3O2/c1-3-27(4-2)9-10-29-18-6-8-21-15(12-18)11-17(25-21)14-20-19-13-16(24)5-7-22(19)26-23(20)28/h5-8,11-14,25H,3-4,9-10H2,1-2H3,(H,26,28)/b20-14- |
| InChIKey | CLHAWQLVAGJZPC-ZHZULCJRSA-N |
| XLogP | 5.14 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|