C27H37BrN4O2 — CID 67281072
5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-N-[3-(diethylamino)propyl]-2,4-di(propan-2-yl)-1H-pyrrole-3-carboxamide (PubChem CID 67281072) has the molecular formula C27H37BrN4O2 and a molecular weight of 529.52 g/mol. Its IUPAC name is 5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-N-[3-(diethylamino)propyl]-2,4-di(propan-2-yl)-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-N-[3-(diethylamino)propyl]-2,4-di(propan-2-yl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67281072 |
| Molecular Formula | C27H37BrN4O2 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-N-[3-(diethylamino)propyl]-2,4-di(propan-2-yl)-1H-pyrrole-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1c(C(C)C)[nH]c(C=C2C(=O)Nc3ccc(Br)cc32)c1C(C)C |
| InChI | InChI=1S/C27H37BrN4O2/c1-7-32(8-2)13-9-12-29-27(34)24-23(16(3)4)22(30-25(24)17(5)6)15-20-19-14-18(28)10-11-21(19)31-26(20)33/h10-11,14-17,30H,7-9,12-13H2,1-6H3,(H,29,34)(H,31,33) |
| InChIKey | CVTWKANVXMMHOF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|