C20H20BrN3O4 — CID 67281628
4-acetyl-5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-N-(3-hydroxypropyl)-3-methyl-1H-pyrrole-2-carboxamide (PubChem CID 67281628) has the molecular formula C20H20BrN3O4 and a molecular weight of 446.30 g/mol. Its IUPAC name is 4-acetyl-5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-N-(3-hydroxypropyl)-3-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-N-(3-hydroxypropyl)-3-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 67281628 |
| Molecular Formula | C20H20BrN3O4 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 4-acetyl-5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-N-(3-hydroxypropyl)-3-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c(C=C2C(=O)Nc3ccc(Br)cc32)[nH]c(C(=O)NCCCO)c1C |
| InChI | InChI=1S/C20H20BrN3O4/c1-10-17(11(2)26)16(23-18(10)20(28)22-6-3-7-25)9-14-13-8-12(21)4-5-15(13)24-19(14)27/h4-5,8-9,23,25H,3,6-7H2,1-2H3,(H,22,28)(H,24,27) |
| InChIKey | QNNZZQYGKRHJEQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|