C19H16BrN3O5 — CID 67281468
(2-amino-2-oxoethyl) 4-acetyl-5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylate (PubChem CID 67281468) has the molecular formula C19H16BrN3O5 and a molecular weight of 446.26 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-acetyl-5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 4-acetyl-5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 67281468 |
| Molecular Formula | C19H16BrN3O5 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-acetyl-5-[(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c(C=C2C(=O)Nc3ccc(Br)cc32)[nH]c(C(=O)OCC(N)=O)c1C |
| InChI | InChI=1S/C19H16BrN3O5/c1-8-16(9(2)24)14(22-17(8)19(27)28-7-15(21)25)6-12-11-5-10(20)3-4-13(11)23-18(12)26/h3-6,22H,7H2,1-2H3,(H2,21,25)(H,23,26) |
| InChIKey | ONVCKOCPBBNMAV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|