C28H38BrN3O2 — CID 161401900
(3Z)-5-bromo-3-[[4-[5-(diethylamino)pentanoyl]-3,5-di(propan-2-yl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one (PubChem CID 161401900) has the molecular formula C28H38BrN3O2 and a molecular weight of 528.54 g/mol. Its IUPAC name is (3Z)-5-bromo-3-[[4-[5-(diethylamino)pentanoyl]-3,5-di(propan-2-yl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-bromo-3-[[4-[5-(diethylamino)pentanoyl]-3,5-di(propan-2-yl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 161401900 |
| Molecular Formula | C28H38BrN3O2 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | (3Z)-5-bromo-3-[[4-[5-(diethylamino)pentanoyl]-3,5-di(propan-2-yl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one |
| SMILES | CCN(CC)CCCCC(=O)c1c(C(C)C)[nH]c(/C=C2\C(=O)Nc3ccc(Br)cc32)c1C(C)C |
| InChI | InChI=1S/C28H38BrN3O2/c1-7-32(8-2)14-10-9-11-24(33)26-25(17(3)4)23(30-27(26)18(5)6)16-21-20-15-19(29)12-13-22(20)31-28(21)34/h12-13,15-18,30H,7-11,14H2,1-6H3,(H,31,34)/b21-16- |
| InChIKey | VUIPBZVKDBQNEY-PGMHBOJBSA-N |
| XLogP | 7.21 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|