C24H29N3O2 — CID 57315504
3-[(4-methyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-5-(2-morpholin-4-ylethyl)-1H-indol-2-one (PubChem CID 57315504) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 3-[(4-methyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-5-(2-morpholin-4-ylethyl)-1H-indol-2-one.
| Compound Name | 3-[(4-methyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-5-(2-morpholin-4-ylethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 57315504 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 3-[(4-methyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-5-(2-morpholin-4-ylethyl)-1H-indol-2-one |
| SMILES | CC1CCCc2[nH]c(C=C3C(=O)Nc4ccc(CCN5CCOCC5)cc43)cc21 |
| InChI | InChI=1S/C24H29N3O2/c1-16-3-2-4-22-19(16)14-18(25-22)15-21-20-13-17(5-6-23(20)26-24(21)28)7-8-27-9-11-29-12-10-27/h5-6,13-16,25H,2-4,7-12H2,1H3,(H,26,28) |
| InChIKey | BHBXXKBYRQVPCF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|