C32H32ClNO6S — CID 159825106
[2-chloro-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 5-phenylpentanoate;5-phenylpentanoic acid (PubChem CID 159825106) has the molecular formula C32H32ClNO6S and a molecular weight of 594.13 g/mol. Its IUPAC name is [2-chloro-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 5-phenylpentanoate;5-phenylpentanoic acid.
| Compound Name | [2-chloro-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 5-phenylpentanoate;5-phenylpentanoic acid |
|---|---|
| PubChem CID | 159825106 |
| Molecular Formula | C32H32ClNO6S |
| Molecular Weight | 594.13 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | [2-chloro-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 5-phenylpentanoate;5-phenylpentanoic acid |
| SMILES | O=C(CCCCc1ccccc1)Oc1cccc(/C=C2\SC(=O)NC2=O)c1Cl.O=C(O)CCCCc1ccccc1 |
| InChI | InChI=1S/C21H18ClNO4S.C11H14O2/c22-19-15(13-17-20(25)23-21(26)28-17)10-6-11-16(19)27-18(24)12-5-4-9-14-7-2-1-3-8-14;12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-3,6-8,10-11,13H,4-5,9,12H2,(H,23,25,26);1-3,6-7H,4-5,8-9H2,(H,12,13)/b17-13-; |
| InChIKey | NMSSYGFWMNXFTC-VSORCOHTSA-N |
| XLogP | 7.47 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.13 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|